CAS 70000-62-3
:N-Cyclohexyl-4-methylbenzenemethanamine
Description:
N-Cyclohexyl-4-methylbenzenemethanamine, also known by its CAS number 70000-62-3, is an organic compound characterized by its amine functional group and a complex structure that includes a cyclohexyl group and a methyl-substituted aromatic ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the cyclohexyl group contributes to its hydrophobic characteristics, while the aromatic ring can provide stability and influence reactivity. N-Cyclohexyl-4-methylbenzenemethanamine may be used in various applications, including as an intermediate in organic synthesis or in the production of pharmaceuticals and agrochemicals. Its safety and handling require careful consideration, as amines can be irritants and may pose health risks upon exposure. Overall, this compound's unique structure and properties make it of interest in both industrial and research contexts.
Formula:C14H21N
InChI:InChI=1S/C14H21N/c1-12-7-9-13(10-8-12)11-15-14-5-3-2-4-6-14/h7-10,14-15H,2-6,11H2,1H3
InChI key:InChIKey=PWFKKLWEXVQDPX-UHFFFAOYSA-N
SMILES:C(NC1CCCCC1)C2=CC=C(C)C=C2
Synonyms:- Benzenemethanamine, N-cyclohexyl-4-methyl-
- N-(4-Methylbenzyl)cyclohexanamine
- N-Cyclohexyl-4-methylbenzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.