CAS 70001-21-7
:6-[(11R)-11-hydroxydodecyl]-3-methoxy-2-methylpyridin-4(1H)-one
Description:
The chemical substance known as 6-[(11R)-11-hydroxydodecyl]-3-methoxy-2-methylpyridin-4(1H)-one, with the CAS number 70001-21-7, is a pyridinone derivative characterized by its unique structural features. This compound contains a pyridine ring substituted with a methoxy group and a methyl group, contributing to its potential biological activity. The presence of the long-chain hydroxydodecyl group suggests that it may exhibit amphiphilic properties, which can influence its solubility and interaction with biological membranes. The specific stereochemistry at the 11th carbon (designated as (11R)) indicates that the compound has a defined three-dimensional orientation, which can be crucial for its biological function and interaction with receptors or enzymes. Such compounds are often investigated for their potential applications in pharmaceuticals, particularly in areas related to antimicrobial or anti-inflammatory activities. However, detailed studies on its pharmacokinetics, toxicity, and specific applications would be necessary to fully understand its characteristics and potential uses.
Formula:C19H33NO3
InChI:InChI=1/C19H33NO3/c1-15(21)12-10-8-6-4-5-7-9-11-13-17-14-18(22)19(23-3)16(2)20-17/h14-15,21H,4-13H2,1-3H3,(H,20,22)/t15-/m1/s1
SMILES:C[C@H](CCCCCCCCCCc1cc(=O)c(c(C)[nH]1)OC)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(+)-Melochinine
CAS:(+)-Melochinine is an alkaloid, which is a naturally occurring compound typically derived from plants. It is sourced primarily from certain species belonging to the Apocynaceae family. The molecule is characterized by its intricate structure, which plays a crucial role in its biological activity. The mode of action of (+)-Melochinine involves interaction with specific biochemical pathways, potentially influencing receptor binding and enzymatic activity. This interaction is of significant interest for pharmaceutical research, as it may lead to the development of novel therapeutics.Formula:C19H33NO3Purity:Min. 95%Molecular weight:323.47 g/mol
