CAS 70005-88-8
:(2R)-1,2,4-Butanetriol
Description:
(2R)-1,2,4-Butanetriol, with the CAS number 70005-88-8, is a chiral organic compound characterized by its three hydroxyl (-OH) groups, making it a triol. This compound is a derivative of butane and features a specific stereochemistry at the second carbon, which contributes to its unique properties. It is typically a colorless, viscous liquid that is soluble in water due to the presence of multiple hydroxyl groups, which enhance its hydrogen bonding capabilities. (2R)-1,2,4-Butanetriol is often used in various applications, including as a humectant, solvent, and in the synthesis of other chemical compounds. Its hydroxyl groups also make it a potential candidate for use in pharmaceuticals and cosmetics, where it can serve as a moisturizing agent. Additionally, the compound's chirality may influence its biological activity, making it of interest in medicinal chemistry. Overall, (2R)-1,2,4-Butanetriol exhibits properties typical of polyols, including hygroscopicity and reactivity in esterification and etherification reactions.
Formula:C4H10O3
InChI:InChI=1S/C4H10O3/c5-2-1-4(7)3-6/h4-7H,1-3H2/t4-/m1/s1
InChI key:InChIKey=ARXKVVRQIIOZGF-SCSAIBSYSA-N
SMILES:[C@@H](CCO)(CO)O
Synonyms:- (+)-1,2,4-Butanetriol
- (2R)-1,2,4-Butanetriol
- (2R)-Butane-1,2,4-triol
- (R)-Butane-1,2,4-triol
- 1,2,4-Butanetriol, (2R)-
- 1,2,4-Butanetriol, (R)-
- (R)-1,2,4-Butanetriol
- (R)-(+)-1,2,4-Butanetriol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(R)-(+)-1,2,4-Butanetriol
CAS:Controlled Product(R)-(+)-1,2,4-Butanetriol is a molecule that has been shown to have cancer-fighting properties. It is used in clinical trials to treat cancer by inhibiting the growth of cells. This drug binds to the site on the protein that is responsible for cell division and prevents the formation of new cells, thereby preventing tumor growth. The mechanism of action for this drug is not yet fully understood but it may be due to its ability to inhibit calcium channels or interfere with protein synthesis. (R)-(+)-1,2,4-Butanetriol has also been shown in laboratory studies to bind with human immunodeficiency virus (HIV) and prevent it from attaching to CD4 T-cells. This drug has been tested in humans as an anti-HIV treatment and showed promising results in a questionnaire study.Formula:C4H10O3Purity:Min. 95%Molecular weight:106.12 g/mol


