CAS 70015-83-7

2,1,3-Benzoxadiazole-4,5-diamine

Description:

2,1,3-Benzoxadiazole-4,5-diamine, with the CAS number 70015-83-7, is an organic compound characterized by its benzoxadiazole core, which consists of a fused benzene and diazole ring system. This compound features amino groups at the 4 and 5 positions of the benzoxadiazole ring, contributing to its reactivity and potential applications in various fields. It is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, depending on the specific substituents and structural characteristics. The presence of amino groups allows for hydrogen bonding and can enhance its interaction with biological systems, making it of interest in medicinal chemistry and materials science. Additionally, compounds of this type may exhibit fluorescence, which can be useful in applications such as sensors or dyes. Overall, 2,1,3-Benzoxadiazole-4,5-diamine is a versatile compound with potential applications in pharmaceuticals, organic electronics, and as a building block for more complex chemical structures.

Formula: C₆H₆N₄O

InChI: InChI=1S/C6H6N4O/c7-3-1-2-4-6(5(3)8)10-11-9-4/h1-2H,7-8H2

InChI key: InChIKey=SHWDQDBUVFATHY-UHFFFAOYSA-N

SMILES: NC=1C=2C(C=CC1N)=NON2

Synonyms:

• 4,5-Benzofurazandiamine
• 2,1,3-Benzoxadiazole-4,5-diamine
• 4,5-Diaminobenzofurazan