CAS 70031-93-5

3-[4-(4-Bromophenyl)-2-thiazolyl]pyridine

Description:

3-[4-(4-Bromophenyl)-2-thiazolyl]pyridine, with the CAS number 70031-93-5, is a heterocyclic organic compound characterized by its complex structure that includes a pyridine ring and a thiazole moiety. This compound features a bromophenyl substituent, which contributes to its unique chemical properties. Typically, compounds of this nature exhibit significant biological activity, making them of interest in medicinal chemistry and drug development. The presence of the bromine atom enhances the compound's lipophilicity and can influence its interaction with biological targets. Additionally, the thiazole ring is known for its role in various pharmacological activities, including antimicrobial and anticancer properties. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 3-[4-(4-Bromophenyl)-2-thiazolyl]pyridine represents a class of compounds that are valuable in research and potential therapeutic applications.

Formula: C₁₄H₉BrN₂S

InChI: InChI=1S/C14H9BrN2S/c15-12-5-3-10(4-6-12)13-9-18-14(17-13)11-2-1-7-16-8-11/h1-9H

InChI key: InChIKey=LGXAFGTVYJRCNW-UHFFFAOYSA-N

SMILES: BrC1=CC=C(C=2N=C(SC2)C=3C=CC=NC3)C=C1

Synonyms:

• Pyridine, 3-[4-(4-bromophenyl)-2-thiazolyl]-
• 4-(4-Bromophenyl)-2-(3-pyridyl)thiazole
• 3-[4-(4-Bromophenyl)-2-thiazolyl]pyridine

4-(4-bromophenyl)-2-(3-pyridyl)-1,3-thiazole

CAS: 70031-93-5

Please enquire for more information about 4-(4-bromophenyl)-2-(3-pyridyl)-1,3-thiazole including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₉BrN₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 317.20 g/mol

Ref: 3D-FB169670