
CAS 700376-58-5
:2-Azabicyclo[3.1.0]hexane-3-carboxamide, (1R,3S,5R)-, 2,2,2-trifluoroacetate (1:1)
Description:
2-Azabicyclo[3.1.0]hexane-3-carboxamide, (1R,3S,5R)-, 2,2,2-trifluoroacetate (1:1) is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring, contributing to its classification as an azabicyclic compound. The presence of the carboxamide functional group indicates potential for hydrogen bonding, influencing its solubility and reactivity. The trifluoroacetate moiety enhances the compound's polarity and may affect its biological activity, making it of interest in medicinal chemistry. The stereochemistry, denoted by the (1R,3S,5R) configuration, suggests specific spatial arrangements that can significantly impact the compound's interactions with biological targets. This compound may exhibit unique pharmacological properties due to its structural features, making it a candidate for further research in drug development. Additionally, its CAS number, 700376-58-5, allows for precise identification in chemical databases, facilitating access to relevant literature and safety data. Overall, this compound's unique characteristics position it as a subject of interest in various fields, including organic synthesis and pharmacology.
Formula:C8H11F3N2O3
InChI:InChI=1S/C6H10N2O.C2HF3O2/c7-6(9)5-2-3-1-4(3)8-5;3-2(4,5)1(6)7/h3-5,8H,1-2H2,(H2,7,9);(H,6,7)/t3-,4-,5+;/m1./s1
InChI key:InChIKey=ANTLFTRMIBAQHA-ZDQHTEEMSA-N
SMILES:C(N)(=O)[C@@H]1C[C@@]2([C@@](C2)(N1)[H])[H].C(C(O)=O)(F)(F)F
Synonyms:- 2-Azabicyclo[3.1.0]hexane-3-carboxamide, (1R,3S,5R)-, 2,2,2-trifluoroacetate (1:1)
- 2-Azabicyclo[3.1.0]hexane-3-carboxamide, (1R,3S,5R)-, mono(trifluoroacetate)
- (1R,3S,5R)-2-Azabicyclo[3.1.0]hexane-3-carboxamide 2,2,2-trifluoroacetate
- Saxagliptin Impurity 27 Trifluoroacetate
- (1R,3S,5R)-2-AZABICYCLO[3.1.0]HEXANE-3-CARBOXAMIDE 2,2,2-TRIFLUOROACETIC ACID
- Saxagliptin Impurity 27
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1R,3S,5R)-2-Azabicyclo[3.1.0]hexane-3-carboxamide 2,2,2-trifluoroacetate
CAS:Formula:C8H11F3N2O3Color and Shape:SolidMolecular weight:240.1797
