CAS 70048-88-3
:1-(3-chlorophenyl)-3,3-dimethyl-butan-1-one
Description:
1-(3-Chlorophenyl)-3,3-dimethyl-butan-1-one, also known by its CAS number 70048-88-3, is an organic compound characterized by its ketone functional group. This substance features a butanone backbone with a chlorophenyl substituent, which contributes to its chemical properties and reactivity. The presence of the chlorine atom on the aromatic ring enhances its electrophilic character, making it potentially useful in various chemical reactions, including electrophilic aromatic substitution. The dimethyl groups on the butanone structure provide steric hindrance, which can influence the compound's reactivity and interaction with other molecules. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as boiling point, melting point, and solubility, can vary based on the specific conditions and purity of the sample. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C12H15ClO
InChI:InChI=1/C12H15ClO/c1-12(2,3)8-11(14)9-5-4-6-10(13)7-9/h4-7H,8H2,1-3H3
SMILES:CC(C)(C)CC(=O)c1cccc(c1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.