CAS 70051-38-6: (1aR,4R,4aR,7S,7aS,7bR)-Decahydro-1,1,4,7-tetramethyl-1H-cycloprop[e]azulene-4,7-diol

Description:The chemical substance known as (1aR,4R,4aR,7S,7aS,7bR)-Decahydro-1,1,4,7-tetramethyl-1H-cycloprop[e]azulene-4,7-diol, with the CAS number 70051-38-6, is a complex organic compound characterized by its unique bicyclic structure, which includes multiple chiral centers. This compound features a decahydro framework, indicating a fully saturated hydrocarbon structure with multiple methyl groups attached, contributing to its overall stability and hydrophobic nature. The presence of hydroxyl (-OH) groups at the 4 and 7 positions suggests that it exhibits alcohol characteristics, which may influence its solubility and reactivity. The stereochemistry of the molecule, denoted by the specific R and S configurations, plays a crucial role in determining its biological activity and interaction with other substances. Such compounds are often studied for their potential applications in pharmaceuticals, fragrances, or as intermediates in organic synthesis. Overall, the structural complexity and functional groups present in this compound make it a subject of interest in various fields of chemical research.

Formula:C₁₅H₂₆O₂

InChI:InChI=1S/C15H26O2/c1-13(2)9-5-7-14(3,16)10-6-8-15(4,17)12(10)11(9)13/h9-12,16-17H,5-8H2,1-4H3/t9-,10-,11-,12-,14-,15+/m1/s1

InChI key:InChIKey=DWNPMJOWAWGIMM-HTKHVQBFSA-N

SMILES:OC1(C)CCC2C(C3C1CCC3(O)C)C2(C)C

Found 3 products.

Product data	Purity	Price range	Estimated delivery
4,10-Aromadendranediol REF: TM-TN2995CAS: 70051-38-6	98%	To inquire	Mon 28 Apr 25
Aromadendrane-4β,10α-diol REF: BP-SBP01901CAS: 70051-38-6	95%~99%	To inquire	Wed 30 Apr 25
4,10-Aromadendranediol REF: 3D-VCA05138CAS: 70051-38-6	Min. 95%	To inquire	Tue 10 Jun 25