CAS 70051-38-6

(1aR,4R,4aR,7S,7aS,7bR)-Decahydro-1,1,4,7-tetramethyl-1H-cycloprop[e]azulene-4,7-diol

Description:

The chemical substance known as (1aR,4R,4aR,7S,7aS,7bR)-Decahydro-1,1,4,7-tetramethyl-1H-cycloprop[e]azulene-4,7-diol, with the CAS number 70051-38-6, is a complex organic compound characterized by its unique bicyclic structure, which includes multiple chiral centers. This compound features a decahydro framework, indicating a fully saturated hydrocarbon structure with multiple methyl groups attached, contributing to its overall stability and hydrophobic nature. The presence of hydroxyl (-OH) groups at the 4 and 7 positions suggests that it exhibits alcohol characteristics, which may influence its solubility and reactivity. The stereochemistry of the molecule, denoted by the specific R and S configurations, plays a crucial role in determining its biological activity and interaction with other substances. Such compounds are often studied for their potential applications in pharmaceuticals, fragrances, or as intermediates in organic synthesis. Overall, the structural complexity and functional groups present in this compound make it a subject of interest in various fields of chemical research.

Formula: C₁₅H₂₆O₂

InChI: InChI=1S/C15H26O2/c1-13(2)9-5-7-14(3,16)10-6-8-15(4,17)12(10)11(9)13/h9-12,16-17H,5-8H2,1-4H3/t9-,10-,11-,12-,14-,15+/m1/s1

InChI key: InChIKey=DWNPMJOWAWGIMM-HTKHVQBFSA-N

SMILES: CC1(C)[C@]2([C@]3([C@]([C@](C)(O)CC[C@]21[H])(CC[C@]3(C)O)[H])[H])[H]

4,10-Aromadendranediol

CAS: 70051-38-6

4,10-Aromadendranediol exhibits neurite outgrowth-inducing activity in neurons via activation of the ERK signaling pathway, which may be beneficial to the

Formula: C₁₅H₂₆O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 238.371

Ref: TM-TN2995

Aromadendrane-4β,10α-diol

CAS: 70051-38-6

Formula: C₁₅H₂₆O₂

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 238.371

Ref: BP-SBP01901

4,10-Aromadendranediol

CAS: 70051-38-6

4,10-Aromadendranediol is a sesquiterpenoid alcohol, which is a naturally occurring compound primarily sourced from essential oils of various plants, including members of the Myrtaceae family. It exhibits a range of potential biological functions attributed to its unique molecular structure. The mode of action of 4,10-Aromadendranediol is largely related to its interactions with lipid membranes and modulation of signaling pathways, which may lead to antioxidant and anti-inflammatory effects.

Formula: C₁₅H₂₆O₂

Purity: Min. 95%

Molecular weight: 238.37 g/mol

Ref: 3D-VCA05138