CAS 70060-13-8
:5-Fluorobenzo[b]thiophene-2-carboxylic acid
Description:
5-Fluorobenzo[b]thiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a fluorinated benzo[b]thiophene moiety and a carboxylic acid functional group. This compound features a fused ring system that combines a benzene ring with a thiophene ring, contributing to its aromatic properties and potential reactivity. The presence of the fluorine atom enhances its electrophilic character and can influence its biological activity, making it of interest in medicinal chemistry. The carboxylic acid group provides acidic properties, allowing for potential interactions in various chemical environments, including hydrogen bonding and coordination with metal ions. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Additionally, its solubility and stability can be influenced by the presence of the fluorine atom and the carboxylic acid group, which are important factors in its application in various chemical and biological systems. Overall, 5-Fluorobenzo[b]thiophene-2-carboxylic acid is a compound of interest due to its structural features and potential applications in chemistry and pharmacology.
Formula:C9H5FO2S
InChI:InChI=1S/C9H5FO2S/c10-6-1-2-7-5(3-6)4-8(13-7)9(11)12/h1-4H,(H,11,12)
InChI key:InChIKey=PLVPMOSTGNZKQQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1SC=2C(C1)=CC(F)=CC2
Synonyms:- 5-Fluoro-1-Benzothiophene-2-Carboxylate
- 5-Fluorobenzo[B]Thiophene-2-Carboxylic Acid
- 5-Fluorobenzothiophene-2-carboxylic acid
- Benzo[B]Thiophene-2-Carboxylic Acid, 5-Fluoro-
- 5-Fluoro-1-benzothiophene-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Fluorobenzo[b]thiophene-2-carboxylic acid, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H4FO2SPurity:96%Color and Shape:Pink, PowderMolecular weight:195.195-Fluorobenzo[b]thiophene-2-carboxylic acid
CAS:Formula:C9H5FO2SPurity:95%Color and Shape:SolidMolecular weight:196.19825-Fluorobenzo[b]thiophene-2-carboxylic acid
CAS:5-Fluorobenzo[b]thiophene-2-carboxylic acidFormula:C9H5FO2SPurity:≥95%Color and Shape: solidMolecular weight:196.20g/mol



