CAS 70065-76-8

2-methyl-N-(pyridin-3-ylmethyl)propan-1-amine

Description:

2-methyl-N-(pyridin-3-ylmethyl)propan-1-amine, with the CAS number 70065-76-8, is an organic compound characterized by its amine functional group and a pyridine ring. This compound features a branched alkyl chain, specifically a propan-1-amine structure, which is substituted with a methyl group and a pyridin-3-ylmethyl moiety. The presence of the pyridine ring imparts unique properties, such as potential basicity and the ability to participate in various chemical reactions, including nucleophilic substitutions. The compound is likely to exhibit moderate solubility in polar solvents due to the amine group, while the hydrophobic alkyl and aromatic components may influence its interaction with non-polar environments. Additionally, the structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit biological activity. Safety and handling precautions should be observed, as with many amines, due to potential irritant properties.

Formula: C₁₀H₁₆N₂

InChI: InChI=1/C10H16N2/c1-9(2)6-12-8-10-4-3-5-11-7-10/h3-5,7,9,12H,6,8H2,1-2H3

SMILES: CC(C)CNCc1cccnc1

2-methyl-N-(3-pyridinylmethyl)-1-propanamine dihydrochloride

CAS: 70065-76-8

Formula: C₁₀H₁₈Cl₂N₂

Purity: 95.0%

Molecular weight: 237.17

Ref: 10-F361106