
CAS 70065-77-9
:N-(3-Methylbutyl)-3-pyridinemethanamine
Description:
N-(3-Methylbutyl)-3-pyridinemethanamine, with the CAS number 70065-77-9, is an organic compound characterized by its pyridine ring and an amine functional group. This substance features a three-carbon branched alkyl chain (3-methylbutyl) attached to the nitrogen of the amine, which influences its solubility and reactivity. The presence of the pyridine ring contributes to its aromatic properties, potentially affecting its interaction with other chemical species. Typically, compounds like this may exhibit basicity due to the nitrogen atom, which can accept protons, and they may participate in hydrogen bonding due to the amine group. The compound's structure suggests potential applications in pharmaceuticals or as a chemical intermediate, although specific uses would depend on its reactivity and biological activity. Safety data should be consulted for handling, as with any chemical, to understand its toxicity, stability, and environmental impact. Overall, N-(3-Methylbutyl)-3-pyridinemethanamine represents a class of compounds with diverse chemical properties and potential applications in various fields.
Formula:C11H18N2
InChI:InChI=1S/C11H18N2/c1-10(2)5-7-13-9-11-4-3-6-12-8-11/h3-4,6,8,10,13H,5,7,9H2,1-2H3
InChI key:InChIKey=FWAXCJBRNYIZRN-UHFFFAOYSA-N
SMILES:C(NCCC(C)C)C=1C=CC=NC1
Synonyms:- N-(3-Methylbutyl)-3-pyridinemethanamine
- 3-Methyl-N-(pyridin-3-ylmethyl)butan-1-amine
- (3-Methyl-butyl)-pyridin-3-ylmethyl-amine
- 3-Pyridinemethanamine, N-(3-methylbutyl)-
- (3-Methylbutyl)(pyridin-3-ylmethyl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.