CAS 70066-67-0
:3′-Bromo[1,1′-biphenyl]-4-ol
Description:
3′-Bromo[1,1′-biphenyl]-4-ol, with the CAS number 70066-67-0, is an organic compound characterized by the presence of a bromine atom and a hydroxyl group attached to a biphenyl structure. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, with the bromine substituent located at the 3′ position of one ring and a hydroxyl group at the 4 position of the other. The presence of the bromine atom introduces notable reactivity, making it useful in various chemical reactions, including electrophilic substitutions. The hydroxyl group contributes to its polarity and potential for hydrogen bonding, influencing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its physical properties, such as melting point and boiling point, can vary based on purity and environmental conditions, but it is generally considered a solid at room temperature. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C12H9BrO
InChI:InChI=1S/C12H9BrO/c13-11-3-1-2-10(8-11)9-4-6-12(14)7-5-9/h1-8,14H
InChI key:InChIKey=WVRJIUQUEYKNPI-UHFFFAOYSA-N
SMILES:BrC=1C=C(C=CC1)C2=CC=C(O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-ol, 3′-bromo-
- 3′-Bromo-4-biphenylol
- 3-Bromo-4′-hydroxybiphenyl
- 3′-Bromo[1,1′-biphenyl]-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.