CAS 7008-63-1
:6-phenylimidazo[2,1-b][1,3]thiazole
Description:
6-Phenylimidazo[2,1-b][1,3]thiazole is a heterocyclic compound characterized by its fused imidazole and thiazole rings, with a phenyl group attached at the 6-position of the imidazole ring. This compound typically exhibits a planar structure, which contributes to its potential for π-π stacking interactions. It is known for its fluorescent properties, making it of interest in various applications, including organic electronics and as a potential probe in biological systems. The presence of both nitrogen and sulfur atoms in its structure imparts unique electronic properties, influencing its reactivity and interaction with other chemical species. Additionally, compounds of this type may exhibit biological activity, including antimicrobial or anticancer properties, although specific activities can vary based on structural modifications and the presence of substituents. Due to its complex structure, 6-phenylimidazo[2,1-b][1,3]thiazole can be synthesized through various organic reactions, often involving cyclization processes. Its study contributes to the broader field of medicinal chemistry and materials science.
Formula:C11H8N2S
InChI:InChI=1/C11H8N2S/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10/h1-8H
SMILES:c1ccc(cc1)c1cn2ccsc2n1
Synonyms:- 6-Phenylimidazo(2,1-b)thiazole
- 6-Phenyl-imidazo[2,1-b]thiazole
- Imidazo(2,1-b)thiazole, 6-phenyl-
- 6-Phenylimidazo[2,1-b][1,3]thiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
6-phenylimidazo[2,1-b][1,3]thiazole
CAS:Formula:C11H8N2SPurity:98%Color and Shape:SolidMolecular weight:200.25966-Phenylimidazo[2,1-b]Thiazole
CAS:6-Phenylimidazo[2,1-b]ThiazolePurity:98%Molecular weight:200.26g/mol6-Phenylimidazo[2,1-b][1,3]thiazole
CAS:6-Phenylimidazo[2,1-b][1,3]thiazole is a chemical compound that has been shown to have antimycobacterial activity. It also has been shown to inhibit the growth of cancer cells in vitro and in vivo. 6-Phenylimidazo[2,1-b][1,3]thiazole is used as a fluorescence probe for the detection of DNA in living cells. The fluorescence of this molecule can be excited by light at a wavelength of 365 nm and emission can be observed at 460 nm. This compound has also been shown to bind with high affinity to microsporum and trichophyton mentagrophytes.Formula:C11H8N2SPurity:Min. 95%Molecular weight:200.26 g/mol



