CAS 700804-00-8

4-Ethyl-2-hydrazinylthiazole

Description:

4-Ethyl-2-hydrazinylthiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of an ethyl group and a hydrazinyl group contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydrazinyl functional group, which can engage in hydrogen bonding. The thiazole moiety is known for its biological activity, often serving as a scaffold in medicinal chemistry. Compounds like 4-Ethyl-2-hydrazinylthiazole may possess potential applications in pharmaceuticals, particularly in the development of anti-cancer or anti-inflammatory agents. Additionally, the hydrazinyl group can participate in various chemical reactions, including condensation and oxidation, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as compounds containing hydrazine derivatives can be hazardous.

Formula: C₅H₉N₃S

InChI: InChI=1S/C5H9N3S/c1-2-4-3-9-5(7-4)8-6/h3H,2,6H2,1H3,(H,7,8)

InChI key: InChIKey=YAYPFXAIPZRGGT-UHFFFAOYSA-N

SMILES: C(C)C=1NC(=NN)SC1

Synonyms:

• 4-Ethyl-2-hydrazinylthiazole
• Thiazole, 4-ethyl-2-hydrazinyl-
• 2(3H)-Thiazolone, 4-ethyl-, hydrazone