CymitQuimica logo

CAS 700815-60-7

:

1-(Cyclobutylcarbonyl)-4-piperidinecarboxylic acid

Description:
1-(Cyclobutylcarbonyl)-4-piperidinecarboxylic acid, with the CAS number 700815-60-7, is a chemical compound characterized by its unique structure that includes a piperidine ring and a cyclobutylcarbonyl group. This compound typically exhibits properties associated with both cyclic and acyclic structures, contributing to its potential biological activity. It is likely to be a solid at room temperature, with solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The piperidine moiety may impart basic characteristics, while the cyclobutyl group can influence the compound's steric and electronic properties. Such compounds are often of interest in medicinal chemistry for their potential as pharmaceuticals, particularly in the development of drugs targeting neurological or pain-related conditions. The specific reactivity and stability of this compound would depend on its environment and the presence of other functional groups, making it a subject of interest for further research and application in various chemical contexts.
Formula:C11H17NO3
InChI:InChI=1S/C11H17NO3/c13-10(8-2-1-3-8)12-6-4-9(5-7-12)11(14)15/h8-9H,1-7H2,(H,14,15)
InChI key:InChIKey=AAZDBTUTEIYUAL-UHFFFAOYSA-N
SMILES:C(=O)(N1CCC(C(O)=O)CC1)C2CCC2
Synonyms:
  • 1-(Cyclobutanecarbonyl)piperidine-4-carboxylic acid
  • 1-(Cyclobutylcarbonyl)-4-Piperidinecarboxylic Acid
  • 4-Piperidinecarboxylic Acid, 1-(Cyclobutylcarbonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.