CymitQuimica logo

CAS 700849-61-2

:

4-(5-oxo-3-propyl-2,5-dihydro-1H-pyrazol-1-yl)benzoic acid

Description:
4-(5-oxo-3-propyl-2,5-dihydro-1H-pyrazol-1-yl)benzoic acid, with the CAS number 700849-61-2, is a chemical compound characterized by its unique structure that includes a pyrazole ring and a benzoic acid moiety. This compound typically exhibits properties associated with both the pyrazole and carboxylic acid functional groups, such as potential acidity due to the carboxylic acid group and the ability to participate in hydrogen bonding. The presence of the propyl group on the pyrazole ring may influence its solubility and hydrophobic characteristics. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific reactivity and stability of this compound can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, 4-(5-oxo-3-propyl-2,5-dihydro-1H-pyrazol-1-yl)benzoic acid represents a complex organic molecule with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H14N2O3
InChI:InChI=1/C13H14N2O3/c1-2-3-10-8-12(16)15(14-10)11-6-4-9(5-7-11)13(17)18/h4-8,14H,2-3H2,1H3,(H,17,18)
SMILES:CCCc1cc(=O)n(c2ccc(cc2)C(=O)O)[nH]1
Synonyms:
  • benzoic acid, 4-(2,5-dihydro-5-oxo-3-propyl-1H-pyrazol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.