CAS 70086-62-3: 1,1,5,5-tetrafluoropentane-2,4-dione

Description:1,1,5,5-Tetrafluoropentane-2,4-dione, with the CAS number 70086-62-3, is a fluorinated organic compound characterized by its unique structure that includes two fluorinated groups and a diketone functional group. This compound typically exhibits a low to moderate volatility and is soluble in organic solvents, making it useful in various chemical applications. The presence of fluorine atoms contributes to its chemical stability and can enhance its reactivity in certain reactions, particularly in the formation of fluorinated derivatives. The diketone structure allows for potential reactivity in condensation reactions and can serve as a precursor for synthesizing more complex fluorinated compounds. Additionally, due to its fluorinated nature, it may exhibit distinct physical properties such as increased hydrophobicity and altered boiling and melting points compared to non-fluorinated analogs. Safety data should be consulted, as fluorinated compounds can have specific environmental and health considerations. Overall, 1,1,5,5-tetrafluoropentane-2,4-dione is of interest in both industrial and research settings for its unique properties and potential applications.

Formula:C₅H₄F₄O₂

InChI:InChI=1/C5H4F4O2/c6-4(7)2(10)1-3(11)5(8)9/h4-5H,1H2

Synonyms:
2,4-Pentanedione, 1,1,5,5-tetrafluoro-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1,1,5,5-Tetrafluoropentane-2,4-dione REF: 10-F024441CAS: 70086-62-3	97.0%	50.00 €~618.00 €	Mon 28 Apr 25
1,1,5,5-TETRAFLUOROPENTANE-2,4-DIONE REF: IN-DA00FCJBCAS: 70086-62-3	98%	To inquire	Fri 02 May 25
1,1,5,5-Tetrafluoropentane-2,4-dione REF: 54-PC51157CAS: 70086-62-3	By gc: 97% (Typical Value in Batch COA)	- - -	Discontinued product
1,1,5,5-Tetrafluoro-2,4-pentanedione REF: 3D-FT82885CAS: 70086-62-3	Min. 95%	- - -	Discontinued product