
CAS 70090-73-2
:Benzene, 1,2-dimethyl-4-(2-propyn-1-yl)-
Description:
Benzene, 1,2-dimethyl-4-(2-propyn-1-yl)-, also known by its CAS number 70090-73-2, is an organic compound characterized by a benzene ring substituted with two methyl groups and a propynyl group. The presence of the benzene ring imparts aromatic properties, including stability and unique reactivity patterns typical of aromatic compounds. The two methyl groups at the 1 and 2 positions contribute to the compound's hydrophobic nature and influence its physical properties, such as boiling and melting points. The propynyl group, which is a terminal alkyne, introduces a triple bond that can participate in various chemical reactions, including addition reactions. This compound is likely to be a colorless liquid or solid, depending on temperature, and may have a characteristic aromatic odor. Its applications may span across organic synthesis, serving as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. As with many aromatic compounds, it is essential to handle it with care due to potential health hazards associated with exposure.
Formula:C11H12
InChI:InChI=1S/C11H12/c1-4-5-11-7-6-9(2)10(3)8-11/h1,6-8H,5H2,2-3H3
InChI key:InChIKey=DHFBWQGACQXKPX-UHFFFAOYSA-N
SMILES:C(C#C)C1=CC(C)=C(C)C=C1
Synonyms:- 1,2-Dimethyl-4-(prop-2-yn-1-yl)benzene
- Benzene, 1,2-dimethyl-4-(2-propynyl)-
- Benzene, 1,2-dimethyl-4-(2-propyn-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.