CAS 70091-21-3

9-(2-chloro-6-fluorobenzyl)-N-methyl-9H-purin-6-amine

Description:

9-(2-Chloro-6-fluorobenzyl)-N-methyl-9H-purin-6-amine, with the CAS number 70091-21-3, is a chemical compound that belongs to the purine class of molecules. It features a purine core, which is a bicyclic structure composed of fused imidazole and pyrimidine rings, making it relevant in various biological processes, particularly in nucleic acid chemistry. The presence of a 2-chloro-6-fluorobenzyl group enhances its potential for biological activity, possibly influencing its interaction with enzymes or receptors. The N-methyl substitution indicates the presence of a methyl group attached to the nitrogen atom, which can affect the compound's solubility and lipophilicity. This compound may exhibit properties such as being a potential pharmacological agent, with applications in medicinal chemistry, particularly in the development of antiviral or anticancer drugs. Its specific characteristics, including solubility, stability, and reactivity, would depend on the molecular interactions and the environment in which it is studied.

Formula: C₁₃H₁₁ClFN₅

InChI: InChI=1/C13H11ClFN5/c1-16-12-11-13(18-6-17-12)20(7-19-11)5-8-9(14)3-2-4-10(8)15/h2-4,6-7H,5H2,1H3,(H,16,17,18)

SMILES: CNc1c2c(ncn1)n(Cc1c(cccc1F)Cl)cn2

Synonyms:

• 9H-purin-6-amine, 9-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-
• 9-(2-Chloro-6-fluorobenzyl)-N-methyl-9H-purin-6-amine