CAS 70091-23-5
:9-(2-chloro-6-fluorobenzyl)-N,N-dimethyl-9H-purin-6-amine
Description:
9-(2-Chloro-6-fluorobenzyl)-N,N-dimethyl-9H-purin-6-amine, with the CAS number 70091-23-5, is a chemical compound that belongs to the purine class of molecules. This substance features a purine core, which is a bicyclic structure composed of fused imidazole and pyrimidine rings, making it relevant in various biochemical processes. The presence of a 2-chloro-6-fluorobenzyl group enhances its lipophilicity and may influence its biological activity, potentially allowing for interactions with specific receptors or enzymes. The dimethylamino group contributes to its basicity and solubility in polar solvents. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its unique structural features could also lead to specific interactions in biological systems, warranting further investigation into its potential applications in drug design or as a biochemical probe. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C14H13ClFN5
InChI:InChI=1/C14H13ClFN5/c1-20(2)13-12-14(18-7-17-13)21(8-19-12)6-9-10(15)4-3-5-11(9)16/h3-5,7-8H,6H2,1-2H3
SMILES:CN(C)c1c2c(ncn1)n(Cc1c(cccc1F)Cl)cn2
Synonyms:- 9H-Purin-6-amine, 9-((2-chloro-6-fluorophenyl)methyl)-N,N-dimethyl-
- 9-(2-Chloro-6-fluorobenzyl)-N,N-dimethyl-9H-purin-6-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.