CymitQuimica logo

CAS 70093-19-5

:

2-chloro-1-[2-(4-fluorophenyl)-1H-indol-3-yl]ethanone

Description:
2-Chloro-1-[2-(4-fluorophenyl)-1H-indol-3-yl]ethanone, with the CAS number 70093-19-5, is a synthetic organic compound characterized by its complex structure, which includes an indole moiety and a chloroacetyl group. This compound typically exhibits a molecular formula that reflects its diverse functional groups, contributing to its potential biological activity. The presence of the chloro group and the fluorophenyl substituent suggests that it may possess interesting electronic properties, which can influence its reactivity and interactions with biological targets. The indole structure is known for its role in various pharmacological activities, making this compound a candidate for research in medicinal chemistry. Its solubility and stability can vary depending on the solvent and conditions, and it may undergo various chemical reactions typical of halogenated ketones, such as nucleophilic substitutions. Overall, 2-chloro-1-[2-(4-fluorophenyl)-1H-indol-3-yl]ethanone represents a compound of interest for further investigation in drug development and chemical synthesis.
Formula:C16H11ClFNO
InChI:InChI=1/C16H11ClFNO/c17-9-14(20)15-12-3-1-2-4-13(12)19-16(15)10-5-7-11(18)8-6-10/h1-8,19H,9H2
SMILES:c1ccc2c(c1)c(C(=O)CCl)c(c1ccc(cc1)F)[nH]2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.