CAS 70097-13-1

2-(4-Nitrophenyl)-4-quinolinecarboxylic acid

Description:

2-(4-Nitrophenyl)-4-quinolinecarboxylic acid, with the CAS number 70097-13-1, is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a carboxylic acid functional group (-COOH) and a nitrophenyl substituent, which contributes to its chemical reactivity and potential applications. The presence of the nitro group (-NO2) typically enhances the compound's electron-withdrawing properties, influencing its acidity and reactivity in various chemical reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its solubility can vary depending on the solvent, and it may show distinct properties such as fluorescence or UV-Vis absorbance due to its aromatic nature. Additionally, the compound's stability and reactivity can be affected by environmental conditions, such as pH and temperature. Overall, 2-(4-Nitrophenyl)-4-quinolinecarboxylic acid is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₆H₁₀N₂O₄

InChI: InChI=1/C16H10N2O4/c19-16(20)13-9-15(17-14-4-2-1-3-12(13)14)10-5-7-11(8-6-10)18(21)22/h1-9H,(H,19,20)

InChI key: InChIKey=PLSLMNLMCJRXHN-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C3=CC=C(N(=O)=O)C=C3)C=CC=C2

Synonyms:

• 2-(4-Nitrophenyl)-4-quinolinecarboxylic acid
• 2-(p-Nitrophenyl)quinoline-4-carboxylic acid
• 4-Quinolinecarboxylic acid, 2-(4-nitrophenyl)-
• 2-(4-Nitrophenyl)quinoline-4-carboxylic acid
• CHEMBRDG-BB 6144076
• 2-(4-nitrophenyl)quinoline-4-carboxylic acid(SALTDATA: FREE)
• 2-(4-NITRO-PHENYL)-QUINOLINE-4-CARBOXYLIC ACID
• AKOS AUF0715