CAS 701-13-3

Pyrrolidinodithiocarbamicacidallylester

Description:

Pyrrolidinodithiocarbamic acid allyl ester, identified by its CAS number 701-13-3, is a chemical compound that belongs to the class of dithiocarbamic acids. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is characterized by the presence of dithiocarbamate functional groups. This compound is typically used in various chemical applications, including as a reagent in organic synthesis and potentially in agricultural chemistry as a pesticide or fungicide. Its structure allows for unique reactivity, particularly in forming metal complexes, which can be useful in catalysis or material science. The compound may exhibit specific physical properties such as solubility in organic solvents and varying stability under different conditions. Safety data should be consulted, as dithiocarbamic compounds can have toxicological implications. Overall, Pyrrolidinodithiocarbamic acid allyl ester is a versatile compound with applications in both research and industry, warranting careful handling and study.

Formula: C₈H₁₃NS₂

InChI: InChI=1/C8H13NS2/c1-2-7-11-8(10)9-5-3-4-6-9/h2H,1,3-7H2

SMILES: C=CCSC(=S)N1CCCC1

Synonyms:

• Pyrrolidinodithiocarbamic acid allyl ester
• Prop-2-En-1-Yl Pyrrolidine-1-Carbodithioate

PYRROLIDINODITHIOCARBAMIC ACID ALLYL ESTER

CAS: 701-13-3

Formula: C₈H₁₄N₂S₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 202.3402

Ref: IN-DA003NPG

Allyl 1-pyrrolidinecarbodithioate

CAS: 701-13-3

Allyl 1-pyrrolidinecarbodithioate

Purity: 95%

Molecular weight: 187.33g/mol

Ref: 54-OR916805

Allyl 1-pyrrolidinecarbodithioate

CAS: 701-13-3

Allyl 1-Pyrrolidinecarbodithioate is a polymerizable compound that can be used as an electrode material. It is a radical and unsaturated compound that has a molecular structure composed of two carbonyl groups, two alkene groups, and two thioether groups. Allyl 1-Pyrrolidinecarbodithioate is soluble in organic solvents such as ethanol and benzene, but not water. This polymer has been shown to be an acid ester, anhydride, and nonaqueous solvent.

Formula: C₈H₁₃NS₂

Purity: Min. 95%

Molecular weight: 187.33 g/mol

Ref: 3D-FA61261