CAS 701-23-5

(4-oxo-2-thioxo-1,3-thiazolidin-5-yl)acetic acid

Description:

(4-Oxo-2-thioxo-1,3-thiazolidin-5-yl)acetic acid, with the CAS number 701-23-5, is a heterocyclic compound characterized by a thiazolidine ring structure that incorporates both sulfur and oxygen atoms. This compound features a thiazolidine core with a ketone and a thione functional group, contributing to its reactivity and potential biological activity. The presence of the acetic acid moiety suggests that it can participate in various chemical reactions, including esterification and amidation. Its unique structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound is typically solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid group. Additionally, it may show potential as a building block in the synthesis of more complex molecules or as a ligand in coordination chemistry. As with many thiazolidine derivatives, it could also be investigated for its potential applications in agriculture or as a pharmaceutical agent.

Formula: C₅H₅NO₃S₂

InChI: InChI=1/C5H5NO3S2/c7-3(8)1-2-4(9)6-5(10)11-2/h2H,1H2,(H,7,8)(H,6,9,10)

SMILES: C(C1C(=NC(=S)S1)O)C(=O)O

Synonyms:

• (4-Oxo-2-Sulfanyl-4,5-Dihydro-1,3-Thiazol-5-Yl)Acetic Acid
• 5-Thiazoleacetic Acid, 4,5-Dihydro-2-Mercapto-4-Oxo-

(2-Mercapto-4-oxo-4,5-dihydro-1,3-thiazol-5-yl)acetic acid

CAS: 701-23-5

(2-Mercapto-4-oxo-4,5-dihydro-1,3-thiazol-5-yl)acetic acid

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 191.23g/mol

Ref: 54-OR450085