CymitQuimica logo

CAS 701-58-6

:

5,5-Dimethyl-3-(methylamino)-2-cyclohexen-1-one

Description:
5,5-Dimethyl-3-(methylamino)-2-cyclohexen-1-one, with the CAS number 701-58-6, is an organic compound characterized by its cyclohexene structure, which features a conjugated double bond system. This compound contains a ketone functional group, indicated by the presence of the carbonyl (C=O) group, and an amine group due to the methylamino substituent. The presence of two methyl groups at the 5-position contributes to its steric properties and may influence its reactivity and solubility. Typically, compounds like this can exhibit interesting chemical behavior, including potential reactivity in electrophilic addition reactions due to the unsaturation in the cyclohexene ring. Additionally, the presence of both the ketone and amine functional groups suggests potential for hydrogen bonding, which can affect its physical properties such as boiling point and solubility in various solvents. Overall, this compound may find applications in organic synthesis or as an intermediate in the production of more complex molecules.
Formula:C9H15NO
InChI:InChI=1S/C9H15NO/c1-9(2)5-7(10-3)4-8(11)6-9/h4,10H,5-6H2,1-3H3
InChI key:InChIKey=KRTIOMAPNBTFRN-UHFFFAOYSA-N
SMILES:N(C)C=1CC(C)(C)CC(=O)C1
Synonyms:
  • 2-Cyclohexen-1-one, 5,5-dimethyl-3-(methylamino)-
  • 5,5-Dimethyl-3-(methylamino)-2-cyclohexen-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.