CAS 701-97-3
:Cyclohexanepropanoic acid
Description:
Cyclohexanepropanoic acid, with the CAS number 701-97-3, is an organic compound characterized by a cyclohexane ring attached to a propanoic acid functional group. This structure imparts both hydrophobic and hydrophilic properties, making it an interesting compound in various chemical applications. It typically appears as a colorless liquid with a distinctive odor. The presence of the carboxylic acid group (-COOH) allows it to participate in acid-base reactions and makes it soluble in polar solvents to some extent. Cyclohexanepropanoic acid can undergo typical organic reactions such as esterification and reduction. Its unique structure may also influence its reactivity and interaction with biological systems, making it of interest in pharmaceuticals and agrochemicals. Additionally, the compound's physical properties, such as boiling point and melting point, are influenced by the cyclohexane ring's stability and the carboxylic acid's ability to form hydrogen bonds. Overall, cyclohexanepropanoic acid is a versatile compound with potential applications in various fields of chemistry.
Formula:C9H16O2
InChI:InChI=1S/C9H16O2/c10-9(11)7-6-8-4-2-1-3-5-8/h8H,1-7H2,(H,10,11)
InChI key:InChIKey=HJZLEGIHUQOJBA-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C1CCCCC1
Synonyms:- 3-Cyclohexanepropanoic Acid
- 3-Cyclohexanepropionic acid
- 3-Cyclohexylpropanoic Acid
- Cyclohexanepropanoic acid
- Cyclohexanepropionic acid
- Cyclohexylpropionic acid
- NSC 404945
- 3-Cyclohexylpropionic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Cyclohexanepropionic Acid
CAS:Formula:C9H16O2Purity:>99.0%(GC)(T)Color and Shape:White or Colorles to Yellow to Orange powder to lump to clear liquidMolecular weight:156.233-Cyclohexylpropionic acid, 98+%
CAS:3-Cyclohexylpropionic acid can be used to produce 3-cyclohexyl-propionyl chloride. It is used as pharmaceutical intermediates in organic synthesis. It can also be used for the synthesis of pineapple esters. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product
Formula:C9H16O2Purity:98+%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:156.23Cyclohexanepropionic acid
CAS:Formula:C9H16O2Purity:97%Color and Shape:LiquidMolecular weight:156.2221Cyclohexanepropanoic Acid
CAS:Applications Cyclohexanepropanoic Acid is a small lead compound that possess potential antifungal properties and effective against candida albicans and sacchromyces cerevisiae.
References Pilehvar-Soltanahmadi, Y., et al.: Novelty in Biomedicine, 2, 47 (2014)Formula:C9H16O2Color and Shape:NeatMolecular weight:156.223-Cyclohexylpropionic acid
CAS:Formula:C9H16O2Purity:95%Color and Shape:ClearMolecular weight:156.225





