CymitQuimica logo

CAS 70101-24-5

:

[(2Z,4Z)-1-(acetyloxy)hexa-2,4-diene-3,4-diyl]dibenzene-4,1-diyl diacetate

Description:
The chemical substance known as [(2Z,4Z)-1-(acetyloxy)hexa-2,4-diene-3,4-diyl]dibenzene-4,1-diyl diacetate, with the CAS number 70101-24-5, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including acetyloxy and diene moieties, which contribute to its reactivity and potential applications in organic synthesis. The presence of dibenzene units suggests that it may exhibit aromatic properties, influencing its stability and interaction with other chemical species. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure indicates potential uses in fields such as materials science, pharmaceuticals, or as intermediates in organic reactions. Additionally, the stereochemistry denoted by the (2Z,4Z) configuration implies specific geometric arrangements that could affect its biological activity and interaction with other molecules. Overall, this compound represents a fascinating example of synthetic organic chemistry with diverse potential applications.
Formula:C24H24O6
InChI:InChI=1/C24H24O6/c1-5-23(19-6-10-21(11-7-19)29-17(3)26)24(14-15-28-16(2)25)20-8-12-22(13-9-20)30-18(4)27/h5-14H,15H2,1-4H3/b23-5-,24-14-
SMILES:C/C=C(/c1ccc(cc1)OC(=O)C)\C(=C/COC(=O)C)\c1ccc(cc1)OC(=O)C
Synonyms:
  • w-Acetoxy-B-dienestroldiacetate
  • 1-O-ACETYL-3,4-BIS-(4-ACETOXYPHENYL)-HEXA-2,4-DIEN-1-OL
  • (Z,Z)-4,4'-[1-[2-(Acetyloxy)ethylidene]-2-ethylidene-1,2-ethanediyl]bis-phenol Diacetate
  • w-Acetoxy--dienestroldiacetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.