CAS 70110-31-5
:2-Bromo-N-[(4-bromophenyl)methyl]acetamide
Description:
2-Bromo-N-[(4-bromophenyl)methyl]acetamide is an organic compound characterized by its brominated structure and amide functional group. It features a bromo substituent on the second carbon of the acetamide moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 4-bromophenyl group enhances its lipophilicity and may influence its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both bromine atoms, which can participate in various chemical reactions. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest for further research in drug discovery. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous. Proper storage conditions and handling protocols are essential to ensure safety and stability.
Formula:C9H9Br2NO
InChI:InChI=1S/C9H9Br2NO/c10-5-9(13)12-6-7-1-3-8(11)4-2-7/h1-4H,5-6H2,(H,12,13)
InChI key:InChIKey=XNQHQAIQNUYJGI-UHFFFAOYSA-N
SMILES:C(NC(CBr)=O)C1=CC=C(Br)C=C1
Synonyms:- 2-Bromo-N-[(4-bromophenyl)methyl]acetamide
- Acetamide, 2-bromo-N-[(4-bromophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.