CAS 70110-38-2
:2-bromo-N-(1-phenylethyl)acetamide
Description:
2-bromo-N-(1-phenylethyl)acetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid. It features a bromine atom attached to the second carbon of the acetamide structure, contributing to its reactivity and potential applications in organic synthesis. The presence of the phenylethyl group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the bromine atom and the phenylethyl moiety, which can affect biological activity. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks typical of halogenated organic substances.
Formula:C10H12BrNO
InChI:InChI=1/C10H12BrNO/c1-8(12-10(13)7-11)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,13)
SMILES:CC(c1ccccc1)N=C(CBr)O
Synonyms:- acetamide, 2-bromo-N-(1-phenylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
