CAS 70110-59-7
:5-n-Heneicosylresorcinol
Description:
5-n-Heneicosylresorcinol is a long-chain alkylphenol derivative characterized by its unique structure, which includes a resorcinol moiety and a heneicosyl (21-carbon) alkyl chain. This compound is typically a white to off-white solid at room temperature and is known for its hydrophobic properties due to the long alkyl chain, which enhances its solubility in organic solvents while making it less soluble in water. It exhibits potential biological activities, including antioxidant and antimicrobial properties, making it of interest in various applications, including cosmetics and pharmaceuticals. The presence of the resorcinol group contributes to its reactivity, allowing for potential modifications and interactions with other chemical entities. Additionally, 5-n-Heneicosylresorcinol may be studied for its role in enhancing skin penetration and stability of formulations. As with many chemical substances, safety and handling precautions should be observed, as the specific toxicological profile may vary based on concentration and exposure routes.
Formula:C27H48O2
InChI:InChI=1S/C27H48O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-22-26(28)24-27(29)23-25/h22-24,28-29H,2-21H2,1H3
InChI key:InChIKey=BLHLKJLSYHEOGY-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCCCCC)C1=CC(O)=CC(O)=C1
Synonyms:- 1,3-Benzenediol, 5-Heneicosyl-
- 1,3-Dihydroxy-5-heneicosylbenzene
- 1,3-Dihydroxy-5-n-heneicosylbenzene
- 5-Heneicosyl-1,3-benzenediol
- 5-Heneicosylresorcinol
- 5-n-Heneicosylresorcinol
- Resorcinol, 5-heneicosyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Heneicosyl-1,3-dihydroxybenzene
CAS:Formula:C27H48O2Purity:95%Color and Shape:SolidMolecular weight:404.66885-Heneicosylresorcinol
CAS:5-Heneicosylresorcinol inhibits β-hexosaminidase, prevents fat in 3T3-L1 cells, kills nematodes with ED50: 80, 30, 180 ug/mL.Formula:C27H48O2Purity:98% - 98%Color and Shape:SolidMolecular weight:404.675-Heneicosylresorcinol
CAS:5-Heneicosylresorcinol is a natural phenolic compound that has been shown to inhibit the growth of bacteria. The effect of 5-Heneicosylresorcinol on bacterial strains was studied by comparing their growth in the presence and absence of this molecule. It has also been shown to have an inhibitory effect on energy metabolism, as it can inhibit the production of ATP. This compound is found in plants such as Fructus Tritici, Aestivum Triticum, and animals feed. This molecule also has homologues that are not yet known.
Formula:C27H48O2Purity:Min. 95%Molecular weight:404.7 g/mol



