CAS 70110-60-0
:5-n-Tricosylresorcinol
Description:
5-n-Tricosylresorcinol is an organic compound characterized by its long aliphatic chain and phenolic structure. It belongs to the class of resorcinols, which are dihydroxybenzene derivatives. The presence of a long n-tricosyl (23 carbon) alkyl chain contributes to its amphiphilic nature, making it soluble in both organic solvents and water to some extent. This compound exhibits properties typical of phenolic compounds, such as antioxidant activity and potential antimicrobial effects. Its structure allows for various applications, particularly in the fields of materials science, cosmetics, and pharmaceuticals, where it may serve as a surfactant or emulsifier. Additionally, the unique combination of hydrophobic and hydrophilic characteristics can enhance the stability and performance of formulations. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential health risks. Overall, 5-n-Tricosylresorcinol is a versatile compound with significant potential in various industrial applications.
Formula:C29H52O2
InChI:InChI=1S/C29H52O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27-24-28(30)26-29(31)25-27/h24-26,30-31H,2-23H2,1H3
InChI key:InChIKey=OHTBGMREZYLZQD-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCCCCCCC)C1=CC(O)=CC(O)=C1
Synonyms:- 1,3-Benzenediol, 5-Tricosyl-
- 1,3-Dihydroxy-5-tricosylbenzene
- 5-Tricosyl-1,3-benzenediol
- 5-Tricosylresorcinol
- 5-n-Tricosylresorcinol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Tricosylbenzene-1,3-diol
CAS:Formula:C29H52O2Purity:98.0%Color and Shape:SolidMolecular weight:432.72205-Tricosyl-1,3-benzenediol
CAS:5-Tricosyl-1,3-benzenediol is a natural product for research related to life sciences. The catalog number is TN3138 and the CAS number is 70110-60-0.Formula:C29H52O2Purity:98%Color and Shape:SolidMolecular weight:432.725-Tricosyl-1,3-benzenediol
CAS:Formula:C29H52O2Purity:95%~99%Color and Shape:PowderMolecular weight:432.7335-Tricosylresorcinol
CAS:<p>5-Tricosylresorcinol is a polyphenolic compound that is found in many plants, such as the seeds of aestivum. It has been shown to be an inhibitor of lipid peroxidation and to have chemiluminescence properties. In addition, 5-Tricosylresorcinol has been shown to have antitumor activity against diploid cells. The mechanism of action for its anticancer effect may include inhibition of fatty acid synthesis, which leads to the formation of fatty acid radicals that can cause DNA damage. 5-Tricosylresorcinol also reduces the production of lysophosphatidic acid, which inhibits the migration and proliferation of cancer cells by blocking G protein signaling pathways.</p>Formula:C29H52O2Purity:Min. 95%Molecular weight:432.72 g/mol




