CAS 70111-45-4

4-[(2-methylpiperidin-1-yl)sulfonyl]benzoic acid

Description:

4-[(2-Methylpiperidin-1-yl)sulfonyl]benzoic acid, identified by the CAS number 70111-45-4, is an organic compound characterized by its sulfonamide functional group and a benzoic acid moiety. This compound features a piperidine ring substituted with a methyl group, which contributes to its steric and electronic properties. The sulfonyl group enhances its solubility in polar solvents and may influence its biological activity. Typically, compounds of this nature are investigated for their potential pharmaceutical applications, particularly in the development of drugs targeting various biological pathways. The presence of both the benzoic acid and piperidine structures suggests potential interactions with biological receptors or enzymes. Additionally, the compound's stability, reactivity, and solubility can be influenced by factors such as pH and temperature, making it important to consider these conditions in experimental settings. Overall, 4-[(2-methylpiperidin-1-yl)sulfonyl]benzoic acid represents a class of compounds with diverse applications in medicinal chemistry and drug design.

Formula: C₁₃H₁₇NO₄S

InChI: InChI=1/C13H17NO4S/c1-10-4-2-3-9-14(10)19(17,18)12-7-5-11(6-8-12)13(15)16/h5-8,10H,2-4,9H2,1H3,(H,15,16)

SMILES: CC1CCCCN1S(=O)(=O)c1ccc(cc1)C(=O)O

Synonyms:

• Benzoic Acid, 4-[(2-Methyl-1-Piperidinyl)Sulfonyl]-

4-[(2-Methylpiperidin-1-yl)sulfonyl]benzoic acid

CAS: 70111-45-4

Versatile small molecule scaffold

Formula: C₁₃H₁₇NO₄S

Purity: Min. 95%

Molecular weight: 283.35 g/mol

Ref: 3D-VCA11145