CAS 70116-00-6
:(S)-[(2R,5R)-5-ethenyl-1-oxido-1-azabicyclo[2.2.2]oct-2-yl](6-methoxyquinolin-4-yl)methanol
Description:
The chemical substance with the name "(S)-[(2R,5R)-5-ethenyl-1-oxido-1-azabicyclo[2.2.2]oct-2-yl](6-methoxyquinolin-4-yl)methanol" and CAS number "70116-00-6" is characterized by its complex bicyclic structure, which includes a nitrogen atom in the bicyclic framework, contributing to its potential biological activity. The presence of the methoxy group on the quinoline moiety enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. The stereochemistry indicated by the (S) and (R) designations suggests specific spatial arrangements that may be crucial for its pharmacological properties. The compound may exhibit various functional properties, including potential antimicrobial or antitumor activities, owing to the presence of both the bicyclic and quinoline structures. Additionally, the oxido group may play a role in reactivity and stability. Overall, this compound represents a class of organic molecules that could be of interest in medicinal chemistry and drug development, particularly for its unique structural features and potential therapeutic applications.
Formula:C20H24N2O3
InChI:InChI=1/C20H24N2O3/c1-3-13-12-22(24)9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(25-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14?,19+,20-,22?/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Quinidine-d3 N-Oxide
CAS:Controlled ProductApplications A Quinidine labelled metabolite.
References Small, D.L., J. Chem. Med., 22,1014 (1979), Guentert, T.W., et al.: Eur. J. Drug Metab. Pharmacokinet., 7, 31 (1982), Chang, Y.F., et al.: Neurochem. Res., 13, 455 (1988),Formula:C20D3H21N2O3Color and Shape:NeatMolecular weight:343.435

