CAS 70117-25-8
:methyl 5-(bromomethyl)furan-2-carboxylate
Description:
Methyl 5-(bromomethyl)furan-2-carboxylate is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a bromomethyl group, which introduces a bromine atom attached to a methylene (-CH2-) group, enhancing its reactivity and potential for further chemical transformations. The presence of the carboxylate group (-COOCH3) indicates that it is an ester, contributing to its solubility in organic solvents and its utility in various chemical reactions, such as nucleophilic substitutions. The compound is likely to exhibit moderate to high reactivity due to the electrophilic nature of the bromomethyl group, making it a valuable intermediate in organic synthesis. Additionally, the furan moiety can participate in various reactions, including electrophilic aromatic substitutions and cycloadditions. Safety considerations should be taken into account when handling this compound, as brominated compounds can be hazardous. Overall, methyl 5-(bromomethyl)furan-2-carboxylate serves as a versatile building block in the synthesis of more complex organic molecules.
Formula:C7H7BrO3
InChI:InChI=1/C7H7BrO3/c1-10-7(9)6-3-2-5(4-8)11-6/h2-3H,4H2,1H3
Synonyms:- 2-furancarboxylic acid, 5-(bromomethyl)-, methyl ester
- methyl 5-(bromomethyl)-2-furoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Furancarboxylic acid, 5-(bromomethyl)-, methyl ester
CAS:2-Furancarboxylic acid, 5-(bromomethyl)-, methyl esterPurity:97%Molecular weight:219.03g/molMethyl 5-(bromomethyl)-2-furoate
CAS:Methyl 5-(bromomethyl)-2-furoate is a polycyclic compound that has been shown to have activity against deacetylases. It is believed to work by binding to the catalytic site of the enzyme, thereby inhibiting acetylation reactions. This results in increased levels of histone acetylation and an improvement in cognition. Methyl 5-(bromomethyl)-2-furoate also has been shown to inhibit phosphodiesterases, which are enzymes that break down cyclic nucleotides in cells.END>Formula:C7H7BrO3Purity:Min. 95%Molecular weight:219.03 g/mol

