CAS 70120-10-4

Benzene, 1-(1,1-dimethyl-2-heptenyl)-3-(phenylmethoxy)-, (Z)-

Description:

Benzene, 1-(1,1-dimethyl-2-heptenyl)-3-(phenylmethoxy)-, (Z)-, with CAS number 70120-10-4, is an organic compound characterized by its complex structure that includes a benzene ring substituted with a phenylmethoxy group and a long aliphatic chain featuring a double bond. The presence of the (Z)- configuration indicates that the substituents around the double bond are on the same side, which can influence the compound's reactivity and physical properties. This compound is likely to exhibit hydrophobic characteristics due to the large hydrocarbon portions, making it less soluble in water but more soluble in organic solvents. Its aromatic nature contributes to stability and potential applications in various chemical reactions, including electrophilic substitutions. Additionally, the presence of multiple functional groups suggests potential for diverse chemical behavior, including interactions with biological systems. Overall, this compound's unique structure may lead to interesting applications in fields such as organic synthesis, materials science, or as a potential intermediate in the production of more complex molecules.

Formula: C₂₂H₂₈O

InChI: InChI=1S/C22H28O/c1-4-5-6-10-16-22(2,3)20-14-11-15-21(17-20)23-18-19-12-8-7-9-13-19/h7-17H,4-6,18H2,1-3H3/b16-10-

InChI key: InChIKey=YCHVOSRRMUALAL-YBEGLDIGSA-N

SMILES: C(/C=C\CCCC)(C)(C)C1=CC(OCC2=CC=CC=C2)=CC=C1

Synonyms:

• Benzene, 1-(1,1-dimethyl-2-heptenyl)-3-(phenylmethoxy)-, (Z)-

(Z)-1-(1,1-Dimethyl-2-heptenyl)-3-(benzyloxy)benzene

Controlled Product

CAS: 70120-10-4

Applications Intermediate in the synthesis of 3-[2-Hydroxy-4-(substituted) phenyl]azacycloalkanes as analgesic agents.

Formula: C₂₂H₂₈O

Color and Shape: Neat

Molecular weight: 308.46

Ref: TR-D473185