
CAS 70124-98-0
:4-Hydroxy-α-(1-methylethyl)benzeneacetic acid
Description:
4-Hydroxy-α-(1-methylethyl)benzeneacetic acid, also known as a derivative of phenolic compounds, is characterized by its aromatic structure featuring a hydroxyl group and an acetic acid moiety. This compound typically exhibits properties associated with both phenols and carboxylic acids, including potential antioxidant activity due to the presence of the hydroxyl group. It is likely to be soluble in polar solvents, such as water and alcohols, while showing limited solubility in non-polar solvents. The presence of the isopropyl group (1-methylethyl) contributes to its hydrophobic characteristics, influencing its reactivity and interaction with biological systems. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Additionally, its structure suggests it could participate in hydrogen bonding, affecting its physical properties and reactivity. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on concentration and exposure routes.
Formula:C11H14O3
InChI:InChI=1S/C11H14O3/c1-7(2)10(11(13)14)8-3-5-9(12)6-4-8/h3-7,10,12H,1-2H3,(H,13,14)
InChI key:InChIKey=GDBITPXOESTAML-UHFFFAOYSA-N
SMILES:C(C(C)C)(C(O)=O)C1=CC=C(O)C=C1
Synonyms:- 4-Hydroxy-α-(1-methylethyl)benzeneacetic acid
- Benzeneacetic acid, 4-hydroxy-α-(1-methylethyl)-
- 2-(4-Hydroxyphenyl)-3-methylbutanoic acid
- 2-(4-Hydroxyphenyl)-3-methylbutyric acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.