
CAS 70125-16-5
:2-AMINO-8-HYDROXYQUINOLINE
Description:
2-Amino-8-hydroxyquinoline is an organic compound characterized by its quinoline structure, which features a hydroxyl group and an amino group at the 8th and 2nd positions, respectively. This compound is typically a yellow to orange crystalline solid and is soluble in polar solvents such as water and alcohols. It exhibits properties that make it useful in various applications, including as a chelating agent for metal ions, particularly in analytical chemistry and biochemistry. The presence of both amino and hydroxyl functional groups allows for hydrogen bonding and enhances its reactivity, making it a potential candidate for various chemical reactions. Additionally, 2-amino-8-hydroxyquinoline has been studied for its biological activities, including antimicrobial and antitumor properties. Its ability to form complexes with metal ions can also be exploited in the development of sensors and catalysts. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure.
Formula:C9H8N2O
InChI:InChI=1/C9H8N2O/c10-8-5-4-6-2-1-3-7(12)9(6)11-8/h1-5,12H,(H2,10,11)
SMILES:c1cc2ccc(=N)[nH]c2c(c1)O
Synonyms:- 2-Aminoquinolin-8-ol
- 8-Quinolinol, 2-Amino-
- 2-Amino-8-quinolinol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-8-hydroxyquinoline
CAS:<p>2-Amino-8-hydroxyquinoline is a molecule that has been shown to have optical properties. 2-Amino-8-hydroxyquinoline has also been shown to be reactive in vitro and inhibit the growth of cancer cells. It is thought that this inhibition may be due to its ability to bind to the active site of DNA polymerase, preventing DNA replication. 2-Amino-8-hydroxyquinoline has also been shown in vitro studies and vivo studies to have potent inhibition activity against human serum albumin (HSA). The molecules that are used as linkers to attach 2-amino 8 hydroxyquinoline to other molecules are thermodynamically stable. The isomers of 2 amino 8 hydroxyquinoline have also been studied by X-ray crystallography and nuclear magnetic resonance spectroscopy, which provides information about the structure of the molecule. Finally, 2 amino 8 hydroxyquinoline has been found to be an odorant</p>Formula:C9H8N2OPurity:Min. 98%Color and Shape:Off-White PowderMolecular weight:160.17 g/mol



