CymitQuimica logo

CAS 70125-18-7

:

2-(Dimethylamino)-8-quinolinol

Description:
2-(Dimethylamino)-8-quinolinol, with the CAS number 70125-18-7, is an organic compound characterized by its quinoline structure, which features a dimethylamino group at the 2-position and a hydroxyl group at the 8-position. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including medicinal chemistry and as a fluorescent probe. It exhibits properties such as being a weak base due to the presence of the dimethylamino group, which can participate in protonation reactions. The hydroxyl group contributes to its ability to form hydrogen bonds, enhancing its solubility in polar solvents. Additionally, 2-(Dimethylamino)-8-quinolinol can exhibit fluorescence, making it useful in biological imaging and as a chelating agent for metal ions. Its chemical reactivity and stability can vary based on environmental conditions, such as pH and temperature, which are important considerations in its practical applications.
Formula:C11H12N2O
InChI:InChI=1S/C11H12N2O/c1-13(2)10-7-6-8-4-3-5-9(14)11(8)12-10/h3-7,14H,1-2H3
InChI key:InChIKey=LGPJCCZQFZBUON-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=CC(N(C)C)=N2)C=CC1
Synonyms:
  • 2-(Dimethylamino)-8-quinolinol
  • 8-Quinolinol, 2-(dimethylamino)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.