CAS 70125-19-8

2-(Diethylamino)-8-quinolinol

Description:

2-(Diethylamino)-8-quinolinol, with the CAS number 70125-19-8, is an organic compound characterized by its quinoline structure, which features a hydroxyl group and a diethylamino substituent. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and analytical chemistry. It exhibits properties such as being a weak base due to the presence of the diethylamino group, which can participate in protonation reactions. The hydroxyl group contributes to its ability to form hydrogen bonds, enhancing its solubility in polar solvents. Additionally, 2-(Diethylamino)-8-quinolinol can act as a chelating agent, interacting with metal ions, which makes it useful in coordination chemistry. Its fluorescence properties may also be exploited in analytical techniques. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, this compound's unique structure and properties make it a subject of interest in various chemical research areas.

Formula: C₁₃H₁₆N₂O

InChI: InChI=1S/C13H16N2O/c1-3-15(4-2)12-9-8-10-6-5-7-11(16)13(10)14-12/h5-9,16H,3-4H2,1-2H3

InChI key: InChIKey=JILVFKYFXCDAJS-UHFFFAOYSA-N

SMILES: OC=1C2=C(C=CC(N(CC)CC)=N2)C=CC1

Synonyms:

• 8-Quinolinol, 2-(diethylamino)-
• 2-(Diethylamino)-8-quinolinol