CymitQuimica logo

CAS 70127-97-8

:

2-Amino-5-ethoxybenzaldehyde

Description:
2-Amino-5-ethoxybenzaldehyde, with the CAS number 70127-97-8, is an organic compound characterized by the presence of an amino group and an aldehyde functional group attached to a benzene ring that also contains an ethoxy substituent. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents due to its aromatic nature. The amino group contributes to its basicity and potential reactivity in various chemical reactions, such as nucleophilic substitutions or condensation reactions. The ethoxy group enhances its solubility and can influence its reactivity and interaction with other molecules. 2-Amino-5-ethoxybenzaldehyde may be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its functional groups that allow for further derivatization. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, considering potential toxicity and reactivity.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c1-2-12-8-3-4-9(10)7(5-8)6-11/h3-6H,2,10H2,1H3
InChI key:InChIKey=QPDRFEQVOROEBR-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(OCC)=CC=C1N
Synonyms:
  • Benzaldehyde, 2-amino-5-ethoxy-
  • 2-Amino-5-ethoxybenzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.