CAS 701278-07-1

2-Amino-9-[(1S,3R,4S)-4-(dimethylphenylsilyl)-3-(hydroxymethyl)-2-methylenecyclopentyl]-1,9-dihydro-6H-purin-6-one

Description:

2-Amino-9-[(1S,3R,4S)-4-(dimethylphenylsilyl)-3-(hydroxymethyl)-2-methylenecyclopentyl]-1,9-dihydro-6H-purin-6-one, with CAS number 701278-07-1, is a complex organic compound characterized by its purine structure, which includes a fused bicyclic system. This compound features an amino group at the 2-position and a hydroxymethyl group at the 4-position of a cyclopentyl ring, contributing to its potential biological activity. The presence of a dimethylphenylsilyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. The stereochemistry indicated by the (1S,3R,4S) configuration suggests specific spatial arrangements that could affect the compound's interactions with biological targets. As a purine derivative, it may exhibit properties relevant to nucleic acid metabolism or enzyme inhibition, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular conformation. Further studies would be necessary to elucidate its biological activity and potential applications.

Formula: C₂₀H₂₅N₅O₂Si

InChI: InChI=1/C20H25N5O2Si/c1-12-14(10-26)16(28(2,3)13-7-5-4-6-8-13)9-15(12)25-11-22-17-18(25)23-20(21)24-19(17)27/h4-8,11,14-16,26H,1,9-10H2,2-3H3,(H3,21,23,24,27)/t14-,15-,16-/m0/s1

SMILES: C=C1[C@H](CO)[C@H](C[C@@H]1n1cnc2c1[nH]c(=N)nc2O)[Si](C)(C)c1ccccc1

Synonyms:

• [1S-(1α,3α,4β)]-2-Amino-9-[4-(dimethylphenylsilyl)-3-(hydroxymethyl)-2-methylenecyclopentyl]-1,9-dihydro-6H-purin-6-one

4-Dehydroxy-4-dimethylphenylsilyl Entecavir

Controlled Product

CAS: 701278-07-1

Formula: C₂₀H₂₅N₅O₂Si

Color and Shape: Neat

Molecular weight: 395.53

Ref: TR-D229190