CAS 7013-05-0

(S)-(+)-4-Amino-3-hydroxybutyric acid

Description:

(S)-(+)-4-Amino-3-hydroxybutyric acid, commonly known as L-threonine, is an amino acid characterized by its chiral center, which gives rise to its specific optical activity. It is a colorless, crystalline solid that is soluble in water, reflecting its polar nature due to the presence of both amino and hydroxyl functional groups. This compound plays a crucial role in protein synthesis and is essential for various metabolic processes in living organisms. As a non-essential amino acid, it can be synthesized in the body but is also obtained from dietary sources, particularly in protein-rich foods. L-threonine is involved in the synthesis of other important biomolecules and contributes to the maintenance of proper immune function. Its molecular structure includes a side chain that contains a hydroxyl group, which enhances its reactivity and interactions in biochemical pathways. Additionally, it is utilized in various applications, including pharmaceuticals and nutritional supplements, due to its beneficial properties in promoting health and well-being.

Formula: C₄H₉NO₃

InChI: InChI=1/C4H9NO3/c5-2-3(6)1-4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m0/s1

Synonyms:

• (3S)-4-Amino-3-hydroxybutanoic acid
• butanoic acid, 4-amino-3-hydroxy-, (3S)-
• (3S)-4-ammonio-3-hydroxybutanoate

(S)-4-Amino-3-hydroxybutanoic acid

CAS: 7013-05-0

Formula: C₄H₉NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 119.1192

Ref: IN-DA0032G3

(S)-4-Amino-3-hydroxybutanoic acid

CAS: 7013-05-0

(S)-4-Amino-3-hydroxybutanoic acid

Purity: 95%

Molecular weight: 119.12g/mol

Ref: 54-OR73709

GABOB (β-hydroxy-GABA)

CAS: 7013-05-0

GABOB, an epilepsy treatment, is GABA's analogue and may act as a neurotransmitter.

Formula: C₄H₉NO₃

Color and Shape: White To Light Yellow Crystal Powder

Molecular weight: 119.12

Ref: TM-T21409

(S)-4-Amino-3-hydroxybutanoic acid

CAS: 7013-05-0

Formula: C₄H₉NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 119.12

Ref: 10-F322054