CymitQuimica logo

CAS 70145-42-5

:

B-iodo-9-bbn

Description:
B-iodo-9-borabicyclo[3.3.1]nonane (B-iodo-9-BBN) is an organoboron compound characterized by its unique bicyclic structure, which includes a boron atom integrated into a bicyclo[3.3.1]nonane framework. This compound is notable for its reactivity, particularly in organic synthesis, where it serves as a versatile reagent for the selective functionalization of organic molecules. B-iodo-9-BBN is often employed in hydroboration reactions, facilitating the addition of boron to alkenes and alkynes, which can subsequently be transformed into alcohols or other functional groups through oxidation. The presence of the iodine atom enhances its electrophilic character, making it a valuable intermediate in various synthetic pathways. Additionally, B-iodo-9-BBN is typically handled under inert atmospheres to prevent degradation or unwanted reactions with moisture or oxygen. Its applications extend to medicinal chemistry and materials science, where it contributes to the development of novel compounds and materials. Overall, B-iodo-9-BBN is a significant reagent in modern organic chemistry, prized for its efficiency and versatility.
Formula:C8H14BI
InChI:InChI=1/C8H14BI/c10-9-7-3-1-4-8(9)6-2-5-7/h7-8H,1-6H2
SMILES:C1CC2CCCC(C1)B2I
Synonyms:
  • 9-Iodo-9-Borabicyclo[3.3.1]Nonane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.