CymitQuimica logo

CAS 70158-60-0

:

2-chloro-3,5-bis(trifluoromethyl)pyridine

Description:
2-Chloro-3,5-bis(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a chlorine atom and two trifluoromethyl groups at the 3 and 5 positions. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It exhibits high thermal stability and is relatively non-polar due to the presence of the trifluoromethyl groups, which enhance its lipophilicity. The trifluoromethyl groups contribute to its strong electron-withdrawing properties, making the compound useful in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. Additionally, the chlorine atom can participate in nucleophilic substitution reactions, further expanding its utility in organic synthesis. Due to its fluorinated nature, this compound may also exhibit unique properties such as increased resistance to degradation and enhanced biological activity. Safety precautions should be taken when handling this substance, as it may pose health risks and environmental concerns.
Formula:C7H2ClF6N
InChI:InChI=1/C7H2ClF6N/c8-5-4(7(12,13)14)1-3(2-15-5)6(9,10)11/h1-2H
InChI key:NZDGCDJQSHKITG-UHFFFAOYSA-N
SMILES:c1c(cnc(c1C(F)(F)F)Cl)C(F)(F)F
Synonyms:
  • Pyridine, 2-Chloro-3,5-Bis(Trifluoromethyl)-
  • 2-Chloro-3,5-bis(trifluoromethyl)pyridine
Found 6 products.