CAS 7017-16-5

N-(3-chlorophenyl)prop-2-enamide

Description:

N-(3-chlorophenyl)prop-2-enamide, also known by its CAS number 7017-16-5, is an organic compound characterized by its amide functional group and an allylic double bond. This compound features a prop-2-enamide structure, where the amide group is attached to a propene backbone, and a 3-chlorophenyl group, indicating the presence of a chlorine atom on the aromatic ring. The presence of the chlorine substituent can influence the compound's reactivity, polarity, and overall chemical behavior. N-(3-chlorophenyl)prop-2-enamide is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties make it of interest in various fields, including medicinal chemistry and materials science, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₉H₈ClNO

InChI: InChI=1/C9H8ClNO/c1-2-9(12)11-8-5-3-4-7(10)6-8/h2-6H,1H2,(H,11,12)

SMILES: C=CC(=Nc1cccc(c1)Cl)O

N-(3-Chlorophenyl)prop-2-enamide

CAS: 7017-16-5

Versatile small molecule scaffold

Formula: C₉H₈ClNO

Purity: Min. 95%

Molecular weight: 181.62 g/mol

Ref: 3D-HAA01716