CAS 7017-50-7

4-Bromo-2-(chloromethyl)-1-propoxybenzene

Description:

4-Bromo-2-(chloromethyl)-1-propoxybenzene, with the CAS number 7017-50-7, is an organic compound characterized by its aromatic structure, which includes a bromine atom and a chloromethyl group attached to a benzene ring. The presence of the propoxy group indicates that it has an ether functional group, contributing to its solubility properties and reactivity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals or agrochemicals. Its molecular structure suggests potential applications in materials science and chemical research due to the presence of halogen substituents, which can influence its reactivity and interaction with other chemical species. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, would be influenced by the substituents on the benzene ring, making it important to consider these factors in practical applications. Safety data should also be reviewed, as halogenated compounds can exhibit toxicity and environmental persistence.

Formula: C₁₀H₁₂BrClO

InChI: InChI=1S/C10H12BrClO/c1-2-5-13-10-4-3-9(11)6-8(10)7-12/h3-4,6H,2,5,7H2,1H3

InChI key: InChIKey=SUCZNPPNJOHWAE-UHFFFAOYSA-N

SMILES: O(CCC)C1=C(CCl)C=C(Br)C=C1

Synonyms:

• Benzene, 4-bromo-2-(chloromethyl)-1-propoxy-
• Ether, 4-bromo-α-chloro-o-tolyl propyl
• 4-Bromo-2-(chloromethyl)-1-propoxybenzene

4-Bromo-2-(chloromethyl)-1-propoxybenzene

CAS: 7017-50-7

Versatile small molecule scaffold

Formula: C₁₀H₁₂BrClO

Purity: Min. 95%

Molecular weight: 263.56 g/mol

Ref: 3D-HAA01750