CAS 7017-52-9

4-bromo-2-(chloromethyl)-1-methoxybenzene

Description:

4-Bromo-2-(chloromethyl)-1-methoxybenzene, with the CAS number 7017-52-9, is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3), a bromine atom, and a chloromethyl group (-CH2Cl) attached to a benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity due to the presence of halogen substituents, which can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The methoxy group contributes to its electron-donating properties, influencing its reactivity and solubility in organic solvents. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. Safety precautions should be taken when handling this substance, as it may pose health risks due to its halogenated nature. Proper storage and disposal methods are essential to mitigate environmental impact.

Formula: C₈H₈BrClO

InChI: InChI=1/C8H8BrClO/c1-11-8-3-2-7(9)4-6(8)5-10/h2-4H,5H2,1H3

SMILES: COc1ccc(cc1CCl)Br

Synonyms:

• 4-Bromo-2-(chloromethyl)phenyl methyl ether
• Benzene, 4-Bromo-2-(Chloromethyl)-1-Methoxy-
• 4-Bromo-2-(chloromethyl)-1-methoxybenzene

4-Bromo-2-(chloromethyl)-1-methoxybenzene

CAS: 7017-52-9

Versatile small molecule scaffold

Formula: C₈H₈BrClO

Purity: Min. 95%

Molecular weight: 235.5 g/mol

Ref: 3D-HAA01752