CAS 70176-69-1
:2-{ethyl[(4-methylphenyl)sulfonyl]amino}benzoic acid
Description:
2-{Ethyl[(4-methylphenyl)sulfonyl]amino}benzoic acid, identified by its CAS number 70176-69-1, is an organic compound characterized by its complex structure that includes a benzoic acid moiety substituted with an ethyl group and a sulfonamide functional group. This compound features a sulfonyl group attached to a 4-methylphenyl ring, which contributes to its chemical reactivity and potential biological activity. The presence of the carboxylic acid group provides acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. The ethyl group enhances the lipophilicity of the molecule, potentially influencing its solubility and permeability in biological systems. Additionally, the sulfonamide group is known for its role in medicinal chemistry, often contributing to the pharmacological properties of compounds. Overall, this substance may exhibit interesting characteristics that could be explored for applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C16H17NO4S
InChI:InChI=1/C16H17NO4S/c1-3-17(15-7-5-4-6-14(15)16(18)19)22(20,21)13-10-8-12(2)9-11-13/h4-11H,3H2,1-2H3,(H,18,19)
SMILES:CCN(c1ccccc1C(=O)O)S(=O)(=O)c1ccc(C)cc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Ethyl-n-(p-toluenesulfonyl)anthranilic acid
CAS:N-Ethyl-n-(p-toluenesulfonyl)anthranilic acid
Molecular weight:319.38g/mol
