CymitQuimica logo

CAS 70179-80-5

:

4,7,10,13,16,19-Hexaoxaheneicosanoic acid, 21-(4-nonylphenoxy)-, sodium salt (1:1)

Description:
4,7,10,13,16,19-Hexaoxaheneicosanoic acid, 21-(4-nonylphenoxy)-, sodium salt (1:1) is a complex amphiphilic compound characterized by its long hydrophilic polyether chain and hydrophobic nonylphenyl group. This structure imparts surfactant properties, making it useful in various applications, including detergents and emulsifiers. The presence of multiple ether linkages contributes to its solubility in both aqueous and organic solvents, enhancing its versatility in formulations. The sodium salt form indicates that it is likely to be soluble in water, which is beneficial for applications in biological and environmental contexts. Additionally, the nonylphenyl moiety can exhibit endocrine-disrupting properties, raising environmental and health concerns. Overall, this compound's unique structure allows it to function effectively in stabilizing emulsions and enhancing the solubility of hydrophobic substances, making it valuable in industrial and research applications. However, its potential ecological impact necessitates careful consideration in its use and disposal.
Formula:C30H52O9·Na
InChI:InChI=1S/C30H52O9.Na/c1-2-3-4-5-6-7-8-9-28-10-12-29(13-11-28)39-27-26-38-25-24-37-23-22-36-21-20-35-19-18-34-17-16-33-15-14-30(31)32;/h10-13H,2-9,14-27H2,1H3,(H,31,32);
InChI key:InChIKey=UYUMNMCYMFEEON-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOCCOCCOCCC(O)=O)C1=CC=C(CCCCCCCCC)C=C1.[Na]
Synonyms:
  • 3,6,9,12,15,18-Hexaoxaheneicosan-21-oic acid, 1-(4-nonylphenoxy)-, sodium salt
  • 4,7,10,13,16,19-Hexaoxaheneicosanoic acid, 21-(4-nonylphenoxy)-, sodium salt (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.