CAS 70185-87-4

2,5-Bis[(1,3-dioxobutyl)amino]benzenesulfonic acid

Description:

2,5-Bis[(1,3-dioxobutyl)amino]benzenesulfonic acid, with the CAS number 70185-87-4, is a chemical compound characterized by its complex structure that includes a sulfonic acid group and multiple dioxobutyl amino substituents. This compound typically exhibits properties such as high solubility in polar solvents due to the presence of the sulfonic acid group, which enhances its ionic character. It is likely to be a solid at room temperature, with potential applications in various fields, including pharmaceuticals and materials science, due to its ability to interact with biological systems and other chemical entities. The presence of multiple functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Additionally, its structural features may confer specific biological activities, making it of interest for research in drug development or as a biochemical probe. Safety data should be consulted for handling and usage, as compounds with sulfonic acid groups can be corrosive and may pose health risks.

Formula: C₁₄H₁₆N₂O₇S

InChI: InChI=1S/C14H16N2O7S/c1-8(17)5-13(19)15-10-3-4-11(12(7-10)24(21,22)23)16-14(20)6-9(2)18/h3-4,7H,5-6H2,1-2H3,(H,15,19)(H,16,20)(H,21,22,23)

InChI key: InChIKey=DIOSHTLNZVXJOF-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C1=C(NC(CC(C)=O)=O)C=CC(NC(CC(C)=O)=O)=C1

Synonyms:

• 2,5-Bis(acetoacetylamino)benzenesulfonic acid
• Benzenesulfonic Acid, 2,5-Bis[(1,3-Dioxobutyl)Amino]-
• 2,5-Bis[(3-Oxobutanoyl)Amino]Benzenesulfonic Acid
• 2,5-Bis[(1,3-Dioxobutyl)Amino]Benzenesulfonic Acid
• 2,5-Bis(1,3-Dioxobutyl)aminobenzenesulfonic Acid